Products 1797008-83-3

CAS 1797008-83-3 is the registry number for 2-(2-Cyclohexyl-2-hydroxy-2-phenylacetyloxy)acetic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxyacetic acid (CAS 1797008-83-3) is a chemical compound with the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. IUPAC name: 2-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxyacetic acid. InChIKey: PFAJVQTUVNVZIP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20O5
Molecular weight292.33 g/mol
IUPAC name2-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxyacetic acid
InChIKeyPFAJVQTUVNVZIP-UHFFFAOYSA-N
SMILESC1CCC(CC1)C(C2=CC=CC=C2)(C(=O)OCC(=O)O)O

Computed by PubChem (NCBI)