Products 1188265-58-8
CAS 1188265-58-8 appears in our catalog under these names: Zonisamide-13C2-15N (Sulfonamide), Zonisamide-13C2-15N, >95% (HPLC), Zonisamide-13C2,15N, Zonisamide–13C2,15N, Zonisamide-13C2-15N. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
1,2-benzoxazol-3-yl(113C)methane(15N)sulfonamide (CAS 1188265-58-8) is a chemical compound with the molecular formula C8H8N2O3S and a molecular weight of 215.21 g/mol. IUPAC name: 1,2-benzoxazol-3-yl(113C)methane(15N)sulfonamide. InChIKey: UBQNRHZMVUUOMG-VDWPWFDKSA-N.
| Molecular formula | C8H8N2O3S |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 1,2-benzoxazol-3-yl(113C)methane(15N)sulfonamide |
| InChIKey | UBQNRHZMVUUOMG-VDWPWFDKSA-N |
| SMILES | C1=CC=C2C(=C1)[13C](=NO2)[13CH2]S(=O)(=O)[15NH2] |
Computed by PubChem (NCBI)