CAS 1609396-63-5 is the registry number for 5-(1H-Imidazol-2-yl)-2-thiophenecarboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(1H-imidazol-2-yl)thiophene-2-carboxylic acid;hydrate (CAS 1609396-63-5) is a chemical compound with the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. IUPAC name: 5-(1H-imidazol-2-yl)thiophene-2-carboxylic acid;hydrate. InChIKey: JWDLYCQRWYXWPL-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3S |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 5-(1H-imidazol-2-yl)thiophene-2-carboxylic acid;hydrate |
| InChIKey | JWDLYCQRWYXWPL-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N1)C2=CC=C(S2)C(=O)O.O |
Computed by PubChem (NCBI)