Products 240431-47-4
CAS 240431-47-4 appears in our catalog under these names: 3-(Carbamothioylamino)-5-hydroxybenzoic acid, 95%, 3-Hydroxy-5-thioureidobenzoic acid, 95+%, 3–(Carbamothioylamino)–5–Hydroxybenzoic Acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-(carbamothioylamino)-5-hydroxybenzoic acid (CAS 240431-47-4) is a chemical compound with the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. IUPAC name: 3-(carbamothioylamino)-5-hydroxybenzoic acid. InChIKey: JPLZEZBRDSVSST-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3S |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 3-(carbamothioylamino)-5-hydroxybenzoic acid |
| InChIKey | JPLZEZBRDSVSST-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1NC(=S)N)O)C(=O)O |
Computed by PubChem (NCBI)