CAS 184696-69-3 appears in our catalog under these names: Cefazedone Impurity 12, Cephalosporin Impurity B, Cephalosporin Lactone Impurity, Desacetyl-7-ACA Lactone, (5aR,6R)-6-Amino-5a,6-dihydroazeto(2,1-b)furo(3,4-d)(1,3)thiazine-1,7(3H,4H)-dione, 95%. Offered by: Chemat Brand, TRC, AmBeed, Biosynth. Available pack sizes: on request, 50mg, 5mg, 10mg, 25mg, 100mg.
(4R,5R)-4-amino-10-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undec-1(8)-ene-3,11-dione (CAS 184696-69-3) is a chemical compound with the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. IUPAC name: (4R,5R)-4-amino-10-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undec-1(8)-ene-3,11-dione. InChIKey: PEXXBWBJJAMURF-CLZZGJSISA-N.
| Molecular formula | C8H8N2O3S |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | (4R,5R)-4-amino-10-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undec-1(8)-ene-3,11-dione |
| InChIKey | PEXXBWBJJAMURF-CLZZGJSISA-N |
| SMILES | C1C2=C(C(=O)O1)N3[C@@H]([C@@H](C3=O)N)SC2 |
Computed by PubChem (NCBI)