Products 955401-05-5
CAS 955401-05-5 is the registry number for 2-(2-Oxopyrrolidin-1-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-oxopyrrolidin-1-yl)-1,3-thiazole-4-carboxylic acid (CAS 955401-05-5) is a chemical compound with the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. IUPAC name: 2-(2-oxopyrrolidin-1-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: WVQAKLRTAWFOSP-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3S |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 2-(2-oxopyrrolidin-1-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | WVQAKLRTAWFOSP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)