CAS 1507862-91-0 appears in our catalog under these names: 5-Methanesulfonyl-1,3-benzoxazol-2-amine, 95%, 5-methanesulfonyl-1,3-benzoxazol-2-amine, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
5-methylsulfonyl-1,3-benzoxazol-2-amine (CAS 1507862-91-0) is a chemical compound with the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. IUPAC name: 5-methylsulfonyl-1,3-benzoxazol-2-amine. InChIKey: UQDHNTALUUSSOR-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3S |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 5-methylsulfonyl-1,3-benzoxazol-2-amine |
| InChIKey | UQDHNTALUUSSOR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)OC(=N2)N |
Computed by PubChem (NCBI)