CAS 1188499-12-8 is the registry number for Ethyl 2-acetamido-4-formylthiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-acetamido-4-formyl-1,3-thiazole-5-carboxylate (CAS 1188499-12-8) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: ethyl 2-acetamido-4-formyl-1,3-thiazole-5-carboxylate. InChIKey: RYDSNUHNOGLRID-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4S |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | ethyl 2-acetamido-4-formyl-1,3-thiazole-5-carboxylate |
| InChIKey | RYDSNUHNOGLRID-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)NC(=O)C)C=O |
Computed by PubChem (NCBI)