Products 1822839-68-8

CAS 1822839-68-8 is the registry number for 5-(Ethoxycarbonyl)-2-(methylthio)pyrimidine-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-ethoxycarbonyl-2-methylsulfanylpyrimidine-4-carboxylic acid (CAS 1822839-68-8) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: 5-ethoxycarbonyl-2-methylsulfanylpyrimidine-4-carboxylic acid. InChIKey: HZPFBHSXXNKJLR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N2O4S
Molecular weight242.25 g/mol
IUPAC name5-ethoxycarbonyl-2-methylsulfanylpyrimidine-4-carboxylic acid
InChIKeyHZPFBHSXXNKJLR-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C(N=C1C(=O)O)SC

Computed by PubChem (NCBI)