CAS 374783-78-5 appears in our catalog under these names: (S)-2-Methyl-1-((4-nitrophenyl)sulfonyl)aziridine, 95%, (S)–2–Methyl–1–((4–nitrophenyl)sulfonyl)aziridine. Offered by: AmBeed, GLPBio. Available pack sizes: 25g, 100mg, 1g, 250mg, 5g.
(2S)-2-methyl-1-(4-nitrophenyl)sulfonylaziridine (CAS 374783-78-5) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: (2S)-2-methyl-1-(4-nitrophenyl)sulfonylaziridine. InChIKey: IPKIIZQGCWXJFM-BYDSUWOYSA-N.
| Molecular formula | C9H10N2O4S |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | (2S)-2-methyl-1-(4-nitrophenyl)sulfonylaziridine |
| InChIKey | IPKIIZQGCWXJFM-BYDSUWOYSA-N |
| SMILES | C[C@H]1CN1S(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)