CAS 118888-64-5 is the registry number for Tulobuterol Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-chlorophenyl)-2,2-dihydroxyethanone (CAS 118888-64-5) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 1-(2-chlorophenyl)-2,2-dihydroxyethanone. InChIKey: AMXOIBFIDSOGMG-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2,2-dihydroxyethanone |
| InChIKey | AMXOIBFIDSOGMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(O)O)Cl |
Computed by PubChem (NCBI)