Products 1189046-41-0
CAS 1189046-41-0 is the registry number for 2-((5-Phenyl-1,2-oxazol-3-yl)formamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[(5-phenyl-1,2-oxazole-3-carbonyl)amino]propanoic acid (CAS 1189046-41-0) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 2-[(5-phenyl-1,2-oxazole-3-carbonyl)amino]propanoic acid. InChIKey: DECWLNWUJLTMSZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 2-[(5-phenyl-1,2-oxazole-3-carbonyl)amino]propanoic acid |
| InChIKey | DECWLNWUJLTMSZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)C1=NOC(=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)