CAS 118923-32-3 is the registry number for 5-Benzo[1,3]dioxol-5-yl-2H-tetrazole. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 2g.
5-(1,3-benzodioxol-5-yl)-2H-tetrazole (CAS 118923-32-3) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yl)-2H-tetrazole. InChIKey: RGZDBHMVHIGDEC-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yl)-2H-tetrazole |
| InChIKey | RGZDBHMVHIGDEC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NNN=N3 |
Computed by PubChem (NCBI)