CAS 1189379-09-6 is the registry number for (2-(3-Chlorophenyl)thiazol-4-yl)methanamine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
[2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride (CAS 1189379-09-6) is a chemical compound with the molecular formula C10H10Cl2N2S and a molecular weight of 261.17 g/mol. IUPAC name: [2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride. InChIKey: DBEFCUHDXFEPSJ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2S |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | [2-(3-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride |
| InChIKey | DBEFCUHDXFEPSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=CS2)CN.Cl |
Computed by PubChem (NCBI)