CAS 1208832-14-7 is the registry number for (4-(4-Chlorophenyl)-1,3-thiazol-2-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[4-(4-chlorophenyl)-1,3-thiazol-2-yl]methanamine;hydrochloride (CAS 1208832-14-7) is a chemical compound with the molecular formula C10H10Cl2N2S and a molecular weight of 261.17 g/mol. IUPAC name: [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methanamine;hydrochloride. InChIKey: QFCQAXZCLOHUPV-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2S |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | [4-(4-chlorophenyl)-1,3-thiazol-2-yl]methanamine;hydrochloride |
| InChIKey | QFCQAXZCLOHUPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)CN)Cl.Cl |
Computed by PubChem (NCBI)