CAS 690632-35-0 is the registry number for [2-(4-Chlorophenyl)-1,3-thiazol-4-yl]methanamine hydrochloride, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 5g.
[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride (CAS 690632-35-0) is a chemical compound with the molecular formula C10H10Cl2N2S and a molecular weight of 261.17 g/mol. IUPAC name: [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride. InChIKey: PNBZPHKDYJHRSP-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2S |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride |
| InChIKey | PNBZPHKDYJHRSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)CN)Cl.Cl |
Computed by PubChem (NCBI)