CAS 2384252-86-0 is the registry number for 2,4-Dichloro-5-isobutylthieno[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-5-(2-methylpropyl)thieno[2,3-d]pyrimidine (CAS 2384252-86-0) is a chemical compound with the molecular formula C10H10Cl2N2S and a molecular weight of 261.17 g/mol. IUPAC name: 2,4-dichloro-5-(2-methylpropyl)thieno[2,3-d]pyrimidine. InChIKey: ATRQSNBZERVYHP-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2S |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | 2,4-dichloro-5-(2-methylpropyl)thieno[2,3-d]pyrimidine |
| InChIKey | ATRQSNBZERVYHP-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CSC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)