CAS 353745-15-0 is the registry number for 5-((4-Chlorophenyl)methyl)-1,3-thiazol-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-amine;hydrochloride (CAS 353745-15-0) is a chemical compound with the molecular formula C10H10Cl2N2S and a molecular weight of 261.17 g/mol. IUPAC name: 5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-amine;hydrochloride. InChIKey: OPNNZWREIGUIFC-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2S |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | 5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | OPNNZWREIGUIFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CN=C(S2)N)Cl.Cl |
Computed by PubChem (NCBI)