CAS 1189479-80-8 appears in our catalog under these names: 4-(2-(5-Ethyl-2-pyridinyl)-d4-ethoxy)benzaldehyde, 4-(2-(5-Ethylpyridin-2-yl)ethoxy)benzaldehyde-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
4-[1,1,2,2-tetradeuterio-2-(5-ethyl-2-pyridinyl)ethoxy]benzaldehyde (CAS 1189479-80-8) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 259.34 g/mol. IUPAC name: 4-[1,1,2,2-tetradeuterio-2-(5-ethyl-2-pyridinyl)ethoxy]benzaldehyde. InChIKey: NTSWGSRJHHXHBB-YQUBHJMPSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | 4-[1,1,2,2-tetradeuterio-2-(5-ethyl-2-pyridinyl)ethoxy]benzaldehyde |
| InChIKey | NTSWGSRJHHXHBB-YQUBHJMPSA-N |
| SMILES | [2H]C([2H])(C1=NC=C(C=C1)CC)C([2H])([2H])OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)