CAS 1189487-82-8 appears in our catalog under these names: Olaquindox-d4, Olaquindox-d4, >95% (HPLC), D4-Olaquindox, D4-Olaquindox, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, MedChemExpress, HPC Standards. Available pack sizes: on request, 2,5mg, 25mg, 10mg, 2.5 mg, 1x10mg, 1x1ml.
3-methyl-4-oxido-1-oxo-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)quinoxalin-1-ium-2-carboxamide (CAS 1189487-82-8) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 267.27 g/mol. IUPAC name: 3-methyl-4-oxido-1-oxo-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)quinoxalin-1-ium-2-carboxamide. InChIKey: TURHTASYUMWZCC-KXGHAPEVSA-N.
| Molecular formula | C12H13N3O4 |
|---|---|
| Molecular weight | 267.27 g/mol |
| IUPAC name | 3-methyl-4-oxido-1-oxo-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)quinoxalin-1-ium-2-carboxamide |
| InChIKey | TURHTASYUMWZCC-KXGHAPEVSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)NC(=O)C1=C(N(C2=CC=CC=C2[N+]1=O)[O-])C |
Computed by PubChem (NCBI)