Products 1189508-77-7
CAS 1189508-77-7 appears in our catalog under these names: Ketoprofen-13C-d3, rac Ketoprofen-13C,d3, >95% (HPLC), Ketoprofen-13C,d3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
2-(3-benzoylphenyl)-3,3,3-trideuterio(313C)propanoic acid (CAS 1189508-77-7) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 258.29 g/mol. IUPAC name: 2-(3-benzoylphenyl)-3,3,3-trideuterio(313C)propanoic acid. InChIKey: DKYWVDODHFEZIM-KQORAOOSSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | 2-(3-benzoylphenyl)-3,3,3-trideuterio(313C)propanoic acid |
| InChIKey | DKYWVDODHFEZIM-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])C(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)