Products 1330260-99-5
CAS 1330260-99-5 appears in our catalog under these names: (S)-(+)-Ketoprofen-13C,d3, >95% (HPLC), (S)-(+)-Ketoprofen-13C,d3. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 2,5mg, 5mg, 5 mg, 2.5 mg, 1 mg, 500 μg.
(2S)-2-(3-benzoylphenyl)-3,3,3-trideuterio(313C)propanoic acid (CAS 1330260-99-5) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 258.29 g/mol. IUPAC name: (2S)-2-(3-benzoylphenyl)-3,3,3-trideuterio(313C)propanoic acid. InChIKey: DKYWVDODHFEZIM-HPZMRZLNSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | (2S)-2-(3-benzoylphenyl)-3,3,3-trideuterio(313C)propanoic acid |
| InChIKey | DKYWVDODHFEZIM-HPZMRZLNSA-N |
| SMILES | [2H][13C]([2H])([2H])[C@@H](C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)