CAS 159490-55-8 appears in our catalog under these names: Ketoprofen-d3, rac Ketoprofen-d3, >95% (HPLC), (±)-Ketoprofen D3 (propionic D3 acid) 100 µg/mL in Acetonitrile, (±)–Ketoprofen–d3, KETOPROFEN-D3 VETRANAL(R). Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 1ml, 5mg, 25mg, 1 mg, 5 mg.
2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoic acid (CAS 159490-55-8) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 257.30 g/mol. IUPAC name: 2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoic acid. InChIKey: DKYWVDODHFEZIM-FIBGUPNXSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 257.30 g/mol |
| IUPAC name | 2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoic acid |
| InChIKey | DKYWVDODHFEZIM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)