Products 1219805-29-4
CAS 1219805-29-4 appears in our catalog under these names: (±)-Ketoprofen-d4 (propionic-d4 acid), >95% (HPLC), (±)-Ketoprofen-d4 (propionic-d4 acid), 99 atom % D, min 98% Chemical Purity, Ketoprofen–d4, Ketoprofen-d4, 98.74%, D4-Ketoprofen, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, CDN, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 5mg, 0,01g, 0,005g, 1mg, 1 mg, 1x1ml.
2-(3-benzoylphenyl)-2,3,3,3-tetradeuteriopropanoic acid (CAS 1219805-29-4) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 258.30 g/mol. IUPAC name: 2-(3-benzoylphenyl)-2,3,3,3-tetradeuteriopropanoic acid. InChIKey: DKYWVDODHFEZIM-RRRGEQHMSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-(3-benzoylphenyl)-2,3,3,3-tetradeuteriopropanoic acid |
| InChIKey | DKYWVDODHFEZIM-RRRGEQHMSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)