Products 1189511-46-3
CAS 1189511-46-3 appears in our catalog under these names: 7-Amino Nitrazepam-d5, >95% (HPLC), 7-Amino Nitrazepam-d5 (1.0mg/ml in Acetonitrile), 7-AMINONITRAZEPAM-D5, 7-Amino nitrazepam-d5. Offered by: TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 1mg, 1x1ml, 1ML, 1 mg, 10 mg.
7-amino-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 1189511-46-3) is a chemical compound with the molecular formula C15H13N3O and a molecular weight of 256.31 g/mol. IUPAC name: 7-amino-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: OYOUQHVDCKOOAL-RALIUCGRSA-N.
| Molecular formula | C15H13N3O |
|---|---|
| Molecular weight | 256.31 g/mol |
| IUPAC name | 7-amino-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | OYOUQHVDCKOOAL-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=NCC(=O)NC3=C2C=C(C=C3)N)[2H])[2H] |
Computed by PubChem (NCBI)