CAS 451515-45-0 appears in our catalog under these names: N-[2-(1H-1,3-Benzodiazol-2-yl)-1-phenylethylidene]hydroxylamine, 95%, N-(2-(1H-1,3-Benzodiazol-2-yl)-1-phenylethylidene)hydroxylamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(NZ)-N-[2-(1H-benzimidazol-2-yl)-1-phenylethylidene]hydroxylamine (CAS 451515-45-0) is a chemical compound with the molecular formula C15H13N3O and a molecular weight of 251.28 g/mol. IUPAC name: (NZ)-N-[2-(1H-benzimidazol-2-yl)-1-phenylethylidene]hydroxylamine. InChIKey: YMHSLWUPHSLIJT-JXAWBTAJSA-N.
| Molecular formula | C15H13N3O |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | (NZ)-N-[2-(1H-benzimidazol-2-yl)-1-phenylethylidene]hydroxylamine |
| InChIKey | YMHSLWUPHSLIJT-JXAWBTAJSA-N |
| SMILES | C1=CC=C(C=C1)/C(=N\O)/CC2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)