Products 861212-74-0
CAS 861212-74-0 is the registry number for 4-Methyl-n-(1h-pyrrolo[2,3-b]pyridin-1-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-methyl-N-pyrrolo[2,3-b]pyridin-1-ylbenzamide (CAS 861212-74-0) is a chemical compound with the molecular formula C15H13N3O and a molecular weight of 251.28 g/mol. IUPAC name: 4-methyl-N-pyrrolo[2,3-b]pyridin-1-ylbenzamide. InChIKey: BDQDVBJQBNRFBF-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 4-methyl-N-pyrrolo[2,3-b]pyridin-1-ylbenzamide |
| InChIKey | BDQDVBJQBNRFBF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)NN2C=CC3=C2N=CC=C3 |
Computed by PubChem (NCBI)