CAS 915922-90-6 is the registry number for 4-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline (CAS 915922-90-6) is a chemical compound with the molecular formula C15H13N3O and a molecular weight of 251.28 g/mol. IUPAC name: 4-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline. InChIKey: QRLNLRHSHPXWCD-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 4-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline |
| InChIKey | QRLNLRHSHPXWCD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NOC(=N2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)