CAS 591755-14-5 appears in our catalog under these names: 6-Amino-3-benzylquinazolin-4(3h)-one, 95%, 6-Amino-3-benzylquinazolin-4(3H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-amino-3-benzylquinazolin-4-one (CAS 591755-14-5) is a chemical compound with the molecular formula C15H13N3O and a molecular weight of 251.28 g/mol. IUPAC name: 6-amino-3-benzylquinazolin-4-one. InChIKey: DOKQVPCDBUOOHH-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 6-amino-3-benzylquinazolin-4-one |
| InChIKey | DOKQVPCDBUOOHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC3=C(C2=O)C=C(C=C3)N |
Computed by PubChem (NCBI)