CAS 915922-84-8 is the registry number for 3-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline (CAS 915922-84-8) is a chemical compound with the molecular formula C15H13N3O and a molecular weight of 251.28 g/mol. IUPAC name: 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline. InChIKey: FPARUHCFXJLAHI-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline |
| InChIKey | FPARUHCFXJLAHI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NOC(=N2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)