CAS 1189817-30-8 appears in our catalog under these names: 4,7-Dibromo-2,3,4,5-tetrahydro-1-benzoxepin-5-one, 95%, 4,7-Dibromo-2,3,4,5-tetrahydro-1-benzoxepin-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,7-dibromo-3,4-dihydro-2H-1-benzoxepin-5-one (CAS 1189817-30-8) is a chemical compound with the molecular formula C10H8Br2O2 and a molecular weight of 319.98 g/mol. IUPAC name: 4,7-dibromo-3,4-dihydro-2H-1-benzoxepin-5-one. InChIKey: ISQJJKIRKHUOOI-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2O2 |
|---|---|
| Molecular weight | 319.98 g/mol |
| IUPAC name | 4,7-dibromo-3,4-dihydro-2H-1-benzoxepin-5-one |
| InChIKey | ISQJJKIRKHUOOI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)Br)C(=O)C1Br |
Computed by PubChem (NCBI)