CAS 946-03-2 appears in our catalog under these names: Ethanone, 1,1'-(1,4-phenylene)bis[2-bromo-, 95%, 95%, 1,1'-(1,4-Phenylene)bis(2-bromoethan-1-one), 97%, 1,4-Bis(bromoacetyl)benzene, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1-[4-(2-bromoacetyl)phenyl]ethanone (CAS 946-03-2) is a chemical compound with the molecular formula C10H8Br2O2 and a molecular weight of 319.98 g/mol. IUPAC name: 2-bromo-1-[4-(2-bromoacetyl)phenyl]ethanone. InChIKey: GIQRKLOVEHCPKT-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2O2 |
|---|---|
| Molecular weight | 319.98 g/mol |
| IUPAC name | 2-bromo-1-[4-(2-bromoacetyl)phenyl]ethanone |
| InChIKey | GIQRKLOVEHCPKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CBr)C(=O)CBr |
Computed by PubChem (NCBI)