CAS 690632-70-3 is the registry number for 2-Bromo-1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethanone, 90% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.
2-bromo-1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethanone (CAS 690632-70-3) is a chemical compound with the molecular formula C10H8Br2O2 and a molecular weight of 319.98 g/mol. IUPAC name: 2-bromo-1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethanone. InChIKey: NPGVDFRSCHXENE-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2O2 |
|---|---|
| Molecular weight | 319.98 g/mol |
| IUPAC name | 2-bromo-1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethanone |
| InChIKey | NPGVDFRSCHXENE-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2C(=O)CBr)Br |
Computed by PubChem (NCBI)