CAS 1415467-17-2 is the registry number for 4,7-Dibromo-2,3-dihydro-1H-indene-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-dibromo-2,3-dihydro-1H-indene-5-carboxylic acid (CAS 1415467-17-2) is a chemical compound with the molecular formula C10H8Br2O2 and a molecular weight of 319.98 g/mol. IUPAC name: 4,7-dibromo-2,3-dihydro-1H-indene-5-carboxylic acid. InChIKey: FGVJLKUNOMOBSB-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2O2 |
|---|---|
| Molecular weight | 319.98 g/mol |
| IUPAC name | 4,7-dibromo-2,3-dihydro-1H-indene-5-carboxylic acid |
| InChIKey | FGVJLKUNOMOBSB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C(=C2C1)Br)C(=O)O)Br |
Computed by PubChem (NCBI)