Products 1415467-17-2

CAS 1415467-17-2 is the registry number for 4,7-Dibromo-2,3-dihydro-1H-indene-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4,7-dibromo-2,3-dihydro-1H-indene-5-carboxylic acid (CAS 1415467-17-2) is a chemical compound with the molecular formula C10H8Br2O2 and a molecular weight of 319.98 g/mol. IUPAC name: 4,7-dibromo-2,3-dihydro-1H-indene-5-carboxylic acid. InChIKey: FGVJLKUNOMOBSB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8Br2O2
Molecular weight319.98 g/mol
IUPAC name4,7-dibromo-2,3-dihydro-1H-indene-5-carboxylic acid
InChIKeyFGVJLKUNOMOBSB-UHFFFAOYSA-N
SMILESC1CC2=C(C=C(C(=C2C1)Br)C(=O)O)Br

Computed by PubChem (NCBI)