Products 1342486-85-4
CAS 1342486-85-4 is the registry number for 7,9-Dibromo-3,4-dihydrobenzo[b]oxepin-5(2H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7,9-dibromo-3,4-dihydro-2H-1-benzoxepin-5-one (CAS 1342486-85-4) is a chemical compound with the molecular formula C10H8Br2O2 and a molecular weight of 319.98 g/mol. IUPAC name: 7,9-dibromo-3,4-dihydro-2H-1-benzoxepin-5-one. InChIKey: HXUJKYUTLJZBDG-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2O2 |
|---|---|
| Molecular weight | 319.98 g/mol |
| IUPAC name | 7,9-dibromo-3,4-dihydro-2H-1-benzoxepin-5-one |
| InChIKey | HXUJKYUTLJZBDG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C(=CC(=C2)Br)Br)OC1 |
Computed by PubChem (NCBI)