CAS 253684-21-8 is the registry number for Methyl 4-(2,2-dibromoethenyl)benzoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Methyl 4-(2,2-dibromoethenyl)benzoate (CAS 253684-21-8) is a chemical compound with the molecular formula C10H8Br2O2 and a molecular weight of 319.98 g/mol. IUPAC name: methyl 4-(2,2-dibromoethenyl)benzoate. InChIKey: SIVONPHGRMJFGG-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2O2 |
|---|---|
| Molecular weight | 319.98 g/mol |
| IUPAC name | methyl 4-(2,2-dibromoethenyl)benzoate |
| InChIKey | SIVONPHGRMJFGG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C=C(Br)Br |
Computed by PubChem (NCBI)