Products 1189880-12-3
CAS 1189880-12-3 appears in our catalog under these names: 2-(3-Chlorophenyl)-1-(3-pyridinyl-d4)-1-ethanone, 2-(3-Chlorophenyl)-1-(pyridin-3-yl-d4)ethan-1-one. Offered by: TRC, MedChemExpress. Available pack sizes: 200mg, 20mg, 10 mg, 5 mg, 100 mg, 25 mg, 50 mg.
2-(3-chlorophenyl)-1-(2,4,5,6-tetradeuterio-3-pyridinyl)ethanone (CAS 1189880-12-3) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 235.70 g/mol. IUPAC name: 2-(3-chlorophenyl)-1-(2,4,5,6-tetradeuterio-3-pyridinyl)ethanone. InChIKey: YVCWMYMJVPJFOI-IYPKRFHASA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 235.70 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1-(2,4,5,6-tetradeuterio-3-pyridinyl)ethanone |
| InChIKey | YVCWMYMJVPJFOI-IYPKRFHASA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C(=O)CC2=CC(=CC=C2)Cl)[2H] |
Computed by PubChem (NCBI)