Products 31251-55-5

CAS 31251-55-5 is the registry number for Loratadine Impurity 43. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-(3-chlorophenyl)-1-pyridin-3-ylethanone (CAS 31251-55-5) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: 2-(3-chlorophenyl)-1-pyridin-3-ylethanone. InChIKey: YVCWMYMJVPJFOI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO
Molecular weight231.68 g/mol
IUPAC name2-(3-chlorophenyl)-1-pyridin-3-ylethanone
InChIKeyYVCWMYMJVPJFOI-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)CC(=O)C2=CN=CC=C2

Computed by PubChem (NCBI)