CAS 31251-55-5 is the registry number for Loratadine Impurity 43. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-(3-chlorophenyl)-1-pyridin-3-ylethanone (CAS 31251-55-5) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: 2-(3-chlorophenyl)-1-pyridin-3-ylethanone. InChIKey: YVCWMYMJVPJFOI-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1-pyridin-3-ylethanone |
| InChIKey | YVCWMYMJVPJFOI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)