CAS 1189883-79-1 appears in our catalog under these names: Flavoxate EP Impurity A-d5, 3-Methylflavone-8-carboxylic Acid-d5. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 1 mg, 10 mg.
3-methyl-4-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)chromene-8-carboxylic acid (CAS 1189883-79-1) is a chemical compound with the molecular formula C17H12O4 and a molecular weight of 285.30 g/mol. IUPAC name: 3-methyl-4-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)chromene-8-carboxylic acid. InChIKey: KMMBBZOSQNLLMN-QRKCWBMQSA-N.
| Molecular formula | C17H12O4 |
|---|---|
| Molecular weight | 285.30 g/mol |
| IUPAC name | 3-methyl-4-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)chromene-8-carboxylic acid |
| InChIKey | KMMBBZOSQNLLMN-QRKCWBMQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=O)C3=C(O2)C(=CC=C3)C(=O)O)C)[2H])[2H] |
Computed by PubChem (NCBI)