Products 1454619-70-5
CAS 1454619-70-5 appears in our catalog under these names: Furano(2“，3“：7，6)–4'–hydroxyflavanone, Furano(2,3:7,6)-4'-hydroxyflavanone, Furano(2'',3'',7,6)-4'-hydroxyflavanone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
7-(4-hydroxyphenyl)-6,7-dihydrofuro[3,2-g]chromen-5-one (CAS 1454619-70-5) is a chemical compound with the molecular formula C17H12O4 and a molecular weight of 280.27 g/mol. IUPAC name: 7-(4-hydroxyphenyl)-6,7-dihydrofuro[3,2-g]chromen-5-one. InChIKey: ZPDVPPPMIRNLSA-UHFFFAOYSA-N.
| Molecular formula | C17H12O4 |
|---|---|
| Molecular weight | 280.27 g/mol |
| IUPAC name | 7-(4-hydroxyphenyl)-6,7-dihydrofuro[3,2-g]chromen-5-one |
| InChIKey | ZPDVPPPMIRNLSA-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C1=O)C=C3C=COC3=C2)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)