Products 2917597-42-1

CAS 2917597-42-1 is the registry number for 2-Oxo-4-(o-tolyl)-2H-chromene-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2-methylphenyl)-2-oxochromene-7-carboxylic acid (CAS 2917597-42-1) is a chemical compound with the molecular formula C17H12O4 and a molecular weight of 280.27 g/mol. IUPAC name: 4-(2-methylphenyl)-2-oxochromene-7-carboxylic acid. InChIKey: LWKKZTSDGURILL-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12O4
Molecular weight280.27 g/mol
IUPAC name4-(2-methylphenyl)-2-oxochromene-7-carboxylic acid
InChIKeyLWKKZTSDGURILL-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1C2=CC(=O)OC3=C2C=CC(=C3)C(=O)O

Computed by PubChem (NCBI)