Products 1440545-28-7
CAS 1440545-28-7 appears in our catalog under these names: Benzyl (E)-2-(2-oxobenzofuran-3(2H)-ylidene)acetate, 98%, BENZYL (E)-2-(2-OXOBENZOFURAN-3(2H)-YLID. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 100MG.
Benzyl (2E)-2-(2-oxo-1-benzofuran-3-ylidene)acetate (CAS 1440545-28-7) is a chemical compound with the molecular formula C17H12O4 and a molecular weight of 280.27 g/mol. IUPAC name: benzyl (2E)-2-(2-oxo-1-benzofuran-3-ylidene)acetate. InChIKey: HXSOJKAKJXISCE-GXDHUFHOSA-N.
| Molecular formula | C17H12O4 |
|---|---|
| Molecular weight | 280.27 g/mol |
| IUPAC name | benzyl (2E)-2-(2-oxo-1-benzofuran-3-ylidene)acetate |
| InChIKey | HXSOJKAKJXISCE-GXDHUFHOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)/C=C/2\C3=CC=CC=C3OC2=O |
Computed by PubChem (NCBI)