Products 556034-11-8
CAS 556034-11-8 is the registry number for 4-((4-Oxochroman-3-ylidene)methyl)benzoic acid. Offered by: Chemat. Available pack sizes: 5g.
4-[(E)-(4-oxochromen-3-ylidene)methyl]benzoic acid (CAS 556034-11-8) is a chemical compound with the molecular formula C17H12O4 and a molecular weight of 280.27 g/mol. IUPAC name: 4-[(E)-(4-oxochromen-3-ylidene)methyl]benzoic acid. InChIKey: CGMWNDIVXUSEJG-UKTHLTGXSA-N.
| Molecular formula | C17H12O4 |
|---|---|
| Molecular weight | 280.27 g/mol |
| IUPAC name | 4-[(E)-(4-oxochromen-3-ylidene)methyl]benzoic acid |
| InChIKey | CGMWNDIVXUSEJG-UKTHLTGXSA-N |
| SMILES | C1/C(=C\C2=CC=C(C=C2)C(=O)O)/C(=O)C3=CC=CC=C3O1 |
Computed by PubChem (NCBI)