CAS 54978-55-1 appears in our catalog under these names: Phenyl 1,4-dihydroxy-2-naphthoate, 98%, Phenyl 1,4–Dihydroxy–2–naphthoate, Phenyl 1,4-dihydroxy-2-naphthoate, Phenyl 1,4-Dihydroxy-2-naphthoate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 250g, 500g, 1000g.
Phenyl 1,4-dihydroxynaphthalene-2-carboxylate (CAS 54978-55-1) is a chemical compound with the molecular formula C17H12O4 and a molecular weight of 280.27 g/mol. IUPAC name: phenyl 1,4-dihydroxynaphthalene-2-carboxylate. InChIKey: XDUXGEPGVNWEBQ-UHFFFAOYSA-N.
| Molecular formula | C17H12O4 |
|---|---|
| Molecular weight | 280.27 g/mol |
| IUPAC name | phenyl 1,4-dihydroxynaphthalene-2-carboxylate |
| InChIKey | XDUXGEPGVNWEBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)C2=C(C3=CC=CC=C3C(=C2)O)O |
Computed by PubChem (NCBI)