CAS 1189950-12-6 is the registry number for Ketoprofen-d3 Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 1mg.
Methyl 2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoate (CAS 1189950-12-6) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 271.32 g/mol. IUPAC name: methyl 2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoate. InChIKey: BIOCOYIPJQMGTN-FIBGUPNXSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 271.32 g/mol |
| IUPAC name | methyl 2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoate |
| InChIKey | BIOCOYIPJQMGTN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)