Products 1189950-12-6

CAS 1189950-12-6 is the registry number for Ketoprofen-d3 Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 1mg.

Structural formula: {0} (CAS {1})

Methyl 2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoate (CAS 1189950-12-6) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 271.32 g/mol. IUPAC name: methyl 2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoate. InChIKey: BIOCOYIPJQMGTN-FIBGUPNXSA-N.

Identity
Molecular formulaC17H16O3
Molecular weight271.32 g/mol
IUPAC namemethyl 2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoate
InChIKeyBIOCOYIPJQMGTN-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)