CAS 81601-91-4 appears in our catalog under these names: Ketoprofen Impurity 27, Dexketoprofen Methyl Ester. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 100mg.
Methyl (2S)-2-(3-benzoylphenyl)propanoate (CAS 81601-91-4) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: methyl (2S)-2-(3-benzoylphenyl)propanoate. InChIKey: BIOCOYIPJQMGTN-LBPRGKRZSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | methyl (2S)-2-(3-benzoylphenyl)propanoate |
| InChIKey | BIOCOYIPJQMGTN-LBPRGKRZSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)