Products 1189961-66-7
CAS 1189961-66-7 is the registry number for 4-(4-Chlorophenyl)cyclohexanol-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-(4-chlorophenyl)-1,2,2,6,6-pentadeuteriocyclohexan-1-ol (CAS 1189961-66-7) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 215.73 g/mol. IUPAC name: 4-(4-chlorophenyl)-1,2,2,6,6-pentadeuteriocyclohexan-1-ol. InChIKey: LKOIMBDVTMGGHH-YKXHHFFSSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 215.73 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1,2,2,6,6-pentadeuteriocyclohexan-1-ol |
| InChIKey | LKOIMBDVTMGGHH-YKXHHFFSSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])O)([2H])[2H])C2=CC=C(C=C2)Cl)[2H] |
Computed by PubChem (NCBI)