CAS 1190315-26-4 is the registry number for 4,5-Dichloro-1h,2h,3h-pyrrolo[2,3-b]pyridin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
4,5-dichloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CAS 1190315-26-4) is a chemical compound with the molecular formula C7H4Cl2N2O and a molecular weight of 203.02 g/mol. IUPAC name: 4,5-dichloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one. InChIKey: RVBQLMVNUYCDTF-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 4,5-dichloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| InChIKey | RVBQLMVNUYCDTF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CN=C2NC1=O)Cl)Cl |
Computed by PubChem (NCBI)