CAS 1190322-13-4 appears in our catalog under these names: 4,6-Dichloro-1h-pyrrolo[2,3-b]pyridin-2(3h)-one, 95%, 4,6–Dichloro–1H–pyrrolo(2,3–b)pyridin–2(3H)–one, 4,6-Dichloro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one 95%, 4,6-Dichloro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg.
4,6-dichloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CAS 1190322-13-4) is a chemical compound with the molecular formula C7H4Cl2N2O and a molecular weight of 203.02 g/mol. IUPAC name: 4,6-dichloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one. InChIKey: BVYWJVMTYRWFEK-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 4,6-dichloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| InChIKey | BVYWJVMTYRWFEK-UHFFFAOYSA-N |
| SMILES | C1C2=C(NC1=O)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)