CAS 16263-60-8 appears in our catalog under these names: 5,7-Dichlorobenzo[d]isoxazol-3-amine, 95%, 5,7–Dichlorobenzo(d)isoxazol–3–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
5,7-dichloro-1,2-benzoxazol-3-amine (CAS 16263-60-8) is a chemical compound with the molecular formula C7H4Cl2N2O and a molecular weight of 203.02 g/mol. IUPAC name: 5,7-dichloro-1,2-benzoxazol-3-amine. InChIKey: UHKAIUSVDOTDNY-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 5,7-dichloro-1,2-benzoxazol-3-amine |
| InChIKey | UHKAIUSVDOTDNY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=NO2)N)Cl)Cl |
Computed by PubChem (NCBI)